C12H12O3 — CID 115023302
methyl (2Z,4E)-5-(3-hydroxyphenyl)penta-2,4-dienoate (PubChem CID 115023302) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl (2Z,4E)-5-(3-hydroxyphenyl)penta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-(3-hydroxyphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 115023302 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | methyl (2Z,4E)-5-(3-hydroxyphenyl)penta-2,4-dienoate |
| SMILES | COC(=O)/C=C\C=C\c1cccc(O)c1 |
| InChI | InChI=1S/C12H12O3/c1-15-12(14)8-3-2-5-10-6-4-7-11(13)9-10/h2-9,13H,1H3/b5-2+,8-3- |
| InChIKey | CLKNCFWMGYDBMJ-GUYPDVCDSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|