C12H14ClNO2 — CID 141059857
5-(3-methoxyphenyl)penta-2,4-dienamide;hydrochloride (PubChem CID 141059857) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)penta-2,4-dienamide;hydrochloride.
| Compound Name | 5-(3-methoxyphenyl)penta-2,4-dienamide;hydrochloride |
|---|---|
| PubChem CID | 141059857 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 5-(3-methoxyphenyl)penta-2,4-dienamide;hydrochloride |
| SMILES | COc1cccc(C=CC=CC(N)=O)c1.Cl |
| InChI | InChI=1S/C12H13NO2.ClH/c1-15-11-7-4-6-10(9-11)5-2-3-8-12(13)14;/h2-9H,1H3,(H2,13,14);1H |
| InChIKey | PMJNDHOSJWEBLN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|