C19H18O3 — CID 75849823
1-(3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 75849823) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75849823 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C=CC(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H18O3/c1-3-13-22-17-10-7-15(8-11-17)9-12-19(20)16-5-4-6-18(14-16)21-2/h3-12,14H,1,13H2,2H3 |
| InChIKey | BFMHOWHCIJAFJI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|