C24H28O4 — CID 54487750
3-(4-tert-butyl-3,5-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 54487750) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-(4-tert-butyl-3,5-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(4-tert-butyl-3,5-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54487750 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-(4-tert-butyl-3,5-dimethoxyphenyl)-1-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C(=O)C=Cc2cc(OC)c(C(C)(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H28O4/c1-7-14-28-19-11-9-18(10-12-19)20(25)13-8-17-15-21(26-5)23(24(2,3)4)22(16-17)27-6/h7-13,15-16H,1,14H2,2-6H3 |
| InChIKey | XTNQEIOWORUTCB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|