C23H28O4 — CID 54217160
3-(2-tert-butyl-3,5-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 54217160) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 3-(2-tert-butyl-3,5-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2-tert-butyl-3,5-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54217160 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-(2-tert-butyl-3,5-dimethoxyphenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)C=Cc2cc(OC)cc(OC)c2C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H28O4/c1-7-27-18-11-8-16(9-12-18)20(24)13-10-17-14-19(25-5)15-21(26-6)22(17)23(2,3)4/h8-15H,7H2,1-6H3 |
| InChIKey | QAAAXZUXQBSPBP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|