C26H34O4 — CID 67778591
(E)-1-(4-ethoxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one (PubChem CID 67778591) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (E)-1-(4-ethoxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethoxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67778591 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (E)-1-(4-ethoxyphenyl)-3-[5-methyl-2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)/C=C/c2cc(C)c(OC(C)(C)C)cc2OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H34O4/c1-9-28-21-13-10-19(11-14-21)22(27)15-12-20-16-18(2)23(29-25(3,4)5)17-24(20)30-26(6,7)8/h10-17H,9H2,1-8H3/b15-12+ |
| InChIKey | GXNMKGYDXFRYGU-NTCAYCPXSA-N |
| XLogP | 6.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|