C17H14F2O2 — CID 75890602
3-(2,5-difluorophenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 75890602) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,5-difluorophenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75890602 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(2,5-difluorophenyl)-1-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C(=O)C=Cc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C17H14F2O2/c1-2-21-15-7-3-12(4-8-15)17(20)10-5-13-11-14(18)6-9-16(13)19/h3-11H,2H2,1H3 |
| InChIKey | REMCBEPSIQZEFZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|