C19H16F2O4 — CID 76863410
4-[4-[3-(2,4-difluorophenyl)prop-2-enoyl]phenoxy]butanoic acid (PubChem CID 76863410) has the molecular formula C19H16F2O4 and a molecular weight of 346.33 g/mol. Its IUPAC name is 4-[4-[3-(2,4-difluorophenyl)prop-2-enoyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[3-(2,4-difluorophenyl)prop-2-enoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 76863410 |
| Molecular Formula | C19H16F2O4 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[4-[3-(2,4-difluorophenyl)prop-2-enoyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(C(=O)C=Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H16F2O4/c20-15-7-3-13(17(21)12-15)6-10-18(22)14-4-8-16(9-5-14)25-11-1-2-19(23)24/h3-10,12H,1-2,11H2,(H,23,24) |
| InChIKey | SOKPYGLFMFAQAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|