C32H35FO3 — CID 174464309
(E)-1-(4-fluorophenyl)-3-[4-[8-(4-prop-1-enylphenoxy)octoxy]phenyl]prop-2-en-1-one (PubChem CID 174464309) has the molecular formula C32H35FO3 and a molecular weight of 486.63 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-3-[4-[8-(4-prop-1-enylphenoxy)octoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-fluorophenyl)-3-[4-[8-(4-prop-1-enylphenoxy)octoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 174464309 |
| Molecular Formula | C32H35FO3 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-3-[4-[8-(4-prop-1-enylphenoxy)octoxy]phenyl]prop-2-en-1-one |
| SMILES | CC=Cc1ccc(OCCCCCCCCOc2ccc(/C=C/C(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H35FO3/c1-2-9-26-10-19-30(20-11-26)35-24-7-5-3-4-6-8-25-36-31-21-12-27(13-22-31)14-23-32(34)28-15-17-29(33)18-16-28/h2,9-23H,3-8,24-25H2,1H3/b9-2?,23-14+ |
| InChIKey | IHQGXXHYPDTFNO-INNXDCDUSA-N |
| XLogP | 8.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|