C43H44FNO7 — CID 59434344
1-[4-[10-[4-[2-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]phenoxy]decoxy]phenyl]pyrrole-2,5-dione (PubChem CID 59434344) has the molecular formula C43H44FNO7 and a molecular weight of 705.82 g/mol. Its IUPAC name is 1-[4-[10-[4-[2-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]phenoxy]decoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[10-[4-[2-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]phenoxy]decoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59434344 |
| Molecular Formula | C43H44FNO7 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 1-[4-[10-[4-[2-[4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]phenoxy]ethoxy]phenoxy]decoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C(/C=C/c1ccc(OCCOc2ccc(OCCCCCCCCCCOc3ccc(N4C(=O)C=CC4=O)cc3)cc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C43H44FNO7/c44-35-14-12-34(13-15-35)41(46)26-11-33-9-18-37(19-10-33)51-31-32-52-40-24-22-39(23-25-40)50-30-8-6-4-2-1-3-5-7-29-49-38-20-16-36(17-21-38)45-42(47)27-28-43(45)48/h9-28H,1-8,29-32H2/b26-11+ |
| InChIKey | GKBHWYIIPJIXCM-KBKYJPHKSA-N |
| XLogP | 9.19 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|