C30H22F3NO7 — CID 139577142
[4-[(E)-3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 139577142) has the molecular formula C30H22F3NO7 and a molecular weight of 565.50 g/mol. Its IUPAC name is [4-[(E)-3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 139577142 |
| Molecular Formula | C30H22F3NO7 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [4-[(E)-3-[4-(2,5-dioxopyrrol-1-yl)phenoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1)Oc1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C30H22F3NO7/c31-30(32,33)18-1-19-39-23-11-5-21(6-12-23)29(38)41-25-9-2-20(3-10-25)4-17-28(37)40-24-13-7-22(8-14-24)34-26(35)15-16-27(34)36/h2-17H,1,18-19H2/b17-4+ |
| InChIKey | TUVZBKOFLUECEX-HAVNEIBRSA-N |
| XLogP | 5.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|