C37H22F7NO9 — CID 146213821
[4-[(E)-3-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]carbonylphenoxy]-3-oxoprop-1-enyl]phenyl] 2,3,5,6-tetrafluoro-4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 146213821) has the molecular formula C37H22F7NO9 and a molecular weight of 757.57 g/mol. Its IUPAC name is [4-[(E)-3-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]carbonylphenoxy]-3-oxoprop-1-enyl]phenyl] 2,3,5,6-tetrafluoro-4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]carbonylphenoxy]-3-oxoprop-1-enyl]phenyl] 2,3,5,6-tetrafluoro-4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 146213821 |
| Molecular Formula | C37H22F7NO9 |
| Molecular Weight | 757.57 g/mol |
| Exact Mass | 757.12 |
| IUPAC Name | [4-[(E)-3-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]carbonylphenoxy]-3-oxoprop-1-enyl]phenyl] 2,3,5,6-tetrafluoro-4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | O=C(/C=C/c1ccc(OC(=O)c2c(F)c(F)c(OCCCC(F)(F)F)c(F)c2F)cc1)Oc1ccc(C(=O)Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C37H22F7NO9/c38-30-29(31(39)33(41)34(32(30)40)51-19-1-18-37(42,43)44)36(50)54-24-9-2-20(3-10-24)4-17-28(48)52-23-11-5-21(6-12-23)35(49)53-25-13-7-22(8-14-25)45-26(46)15-16-27(45)47/h2-17H,1,18-19H2/b17-4+ |
| InChIKey | MVEOXLUILOKMSX-HAVNEIBRSA-N |
| XLogP | 7.45 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|