C27H16N2O6 — CID 138624190
[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 138624190) has the molecular formula C27H16N2O6 and a molecular weight of 464.43 g/mol. Its IUPAC name is [4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | [4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 138624190 |
| Molecular Formula | C27H16N2O6 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl] 4-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | O=C(Oc1ccc(-c2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C27H16N2O6/c30-23-13-14-24(31)28(23)20-7-1-17(2-8-20)18-5-11-22(12-6-18)35-27(34)19-3-9-21(10-4-19)29-25(32)15-16-26(29)33/h1-16H |
| InChIKey | WCKXCPZPAKGQTK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|