C26H16FNO6 — CID 139409021
[4-(2-fluoroprop-2-enoyloxy)phenyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]benzoate (PubChem CID 139409021) has the molecular formula C26H16FNO6 and a molecular weight of 457.41 g/mol. Its IUPAC name is [4-(2-fluoroprop-2-enoyloxy)phenyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]benzoate.
| Compound Name | [4-(2-fluoroprop-2-enoyloxy)phenyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 139409021 |
| Molecular Formula | C26H16FNO6 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [4-(2-fluoroprop-2-enoyloxy)phenyl] 4-[4-(2,5-dioxopyrrol-1-yl)phenyl]benzoate |
| SMILES | C=C(F)C(=O)Oc1ccc(OC(=O)c2ccc(-c3ccc(N4C(=O)C=CC4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H16FNO6/c1-16(27)25(31)33-21-10-12-22(13-11-21)34-26(32)19-4-2-17(3-5-19)18-6-8-20(9-7-18)28-23(29)14-15-24(28)30/h2-15H,1H2 |
| InChIKey | GWBMVSRQRYCBHL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|