C17H11NO6 — CID 58252778
[4-(2,5-dioxopyrrol-1-yl)phenyl] 3,5-dihydroxybenzoate (PubChem CID 58252778) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrol-1-yl)phenyl] 3,5-dihydroxybenzoate.
| Compound Name | [4-(2,5-dioxopyrrol-1-yl)phenyl] 3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 58252778 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [4-(2,5-dioxopyrrol-1-yl)phenyl] 3,5-dihydroxybenzoate |
| SMILES | O=C(Oc1ccc(N2C(=O)C=CC2=O)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H11NO6/c19-12-7-10(8-13(20)9-12)17(23)24-14-3-1-11(2-4-14)18-15(21)5-6-16(18)22/h1-9,19-20H |
| InChIKey | BJDMUMDSOOHJKV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|