C29H25NO3 — CID 22026888
1-[4-[4-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]butyl]phenyl]pyrrole-2,5-dione (PubChem CID 22026888) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-[4-[4-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]butyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]butyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22026888 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[4-[4-[4-[(E)-3-oxo-3-phenylprop-1-enyl]phenyl]butyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C(/C=C/c1ccc(CCCCc2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO3/c31-27(25-8-2-1-3-9-25)19-16-24-12-10-22(11-13-24)6-4-5-7-23-14-17-26(18-15-23)30-28(32)20-21-29(30)33/h1-3,8-21H,4-7H2/b19-16+ |
| InChIKey | JGMNBTMLZCLBNE-KNTRCKAVSA-N |
| XLogP | 5.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|