C32H20N2O6 — CID 139662609
1-[2-[3-[4-[3-[2-(2,5-dioxopyrrol-1-yl)phenyl]-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]phenyl]pyrrole-2,5-dione (PubChem CID 139662609) has the molecular formula C32H20N2O6 and a molecular weight of 528.52 g/mol. Its IUPAC name is 1-[2-[3-[4-[3-[2-(2,5-dioxopyrrol-1-yl)phenyl]-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[3-[4-[3-[2-(2,5-dioxopyrrol-1-yl)phenyl]-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139662609 |
| Molecular Formula | C32H20N2O6 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 1-[2-[3-[4-[3-[2-(2,5-dioxopyrrol-1-yl)phenyl]-3-oxoprop-1-enyl]phenyl]prop-2-enoyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C(C=Cc1ccc(C=CC(=O)c2ccccc2N2C(=O)C=CC2=O)cc1)c1ccccc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C32H20N2O6/c35-27(23-5-1-3-7-25(23)33-29(37)17-18-30(33)38)15-13-21-9-11-22(12-10-21)14-16-28(36)24-6-2-4-8-26(24)34-31(39)19-20-32(34)40/h1-20H |
| InChIKey | AOMQMNSDASINAC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|