C33H24O3 — CID 142713013
1-[2,3-bis(3-phenylprop-2-enoyl)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 142713013) has the molecular formula C33H24O3 and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-[2,3-bis(3-phenylprop-2-enoyl)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2,3-bis(3-phenylprop-2-enoyl)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 142713013 |
| Molecular Formula | C33H24O3 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[2,3-bis(3-phenylprop-2-enoyl)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccc1)c1cccc(C(=O)C=Cc2ccccc2)c1C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C33H24O3/c34-30(22-19-25-11-4-1-5-12-25)28-17-10-18-29(31(35)23-20-26-13-6-2-7-14-26)33(28)32(36)24-21-27-15-8-3-9-16-27/h1-24H |
| InChIKey | VJLMNJSDQICSFP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|