C21H12Na2O5 — CID 20685189
disodium;4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylate (PubChem CID 20685189) has the molecular formula C21H12Na2O5 and a molecular weight of 390.30 g/mol. Its IUPAC name is disodium;4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylate.
| Compound Name | disodium;4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 20685189 |
| Molecular Formula | C21H12Na2O5 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | disodium;4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylate |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(C(=O)[O-])c2c(C(=O)[O-])cccc12.[Na+].[Na+] |
| InChI | InChI=1S/C21H14O5.2Na/c22-18(12-9-13-5-2-1-3-6-13)14-10-11-17(21(25)26)19-15(14)7-4-8-16(19)20(23)24;;/h1-12H,(H,23,24)(H,25,26);;/q;2*+1/p-2/b12-9+;; |
| InChIKey | BCPUYOXOEVBECQ-ANOGCNOSSA-L |
| XLogP | -4.53 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|