C16H12O5 — CID 59967817
4-[(Z)-but-2-enoyl]naphthalene-1,8-dicarboxylic acid (PubChem CID 59967817) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-[(Z)-but-2-enoyl]naphthalene-1,8-dicarboxylic acid.
| Compound Name | 4-[(Z)-but-2-enoyl]naphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 59967817 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 4-[(Z)-but-2-enoyl]naphthalene-1,8-dicarboxylic acid |
| SMILES | C/C=C\C(=O)c1ccc(C(=O)O)c2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C16H12O5/c1-2-4-13(17)9-7-8-12(16(20)21)14-10(9)5-3-6-11(14)15(18)19/h2-8H,1H3,(H,18,19)(H,20,21)/b4-2- |
| InChIKey | PEZUBSZTIMQXIU-RQOWECAXSA-N |
| XLogP | 2.99 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|