C12H14O — CID 54274552
1-(2,3-dimethylphenyl)but-2-en-1-one (PubChem CID 54274552) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)but-2-en-1-one.
| Compound Name | 1-(2,3-dimethylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 54274552 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-(2,3-dimethylphenyl)but-2-en-1-one |
| SMILES | CC=CC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C12H14O/c1-4-6-12(13)11-8-5-7-9(2)10(11)3/h4-8H,1-3H3 |
| InChIKey | RMMMMHVVUSFVID-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|