C9H9IO — CID 87941796
2,3-dimethylbenzoyl iodide (PubChem CID 87941796) has the molecular formula C9H9IO and a molecular weight of 260.07 g/mol. Its IUPAC name is 2,3-dimethylbenzoyl iodide.
| Compound Name | 2,3-dimethylbenzoyl iodide |
|---|---|
| PubChem CID | 87941796 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 2,3-dimethylbenzoyl iodide |
| SMILES | Cc1cccc(C(=O)I)c1C |
| InChI | InChI=1S/C9H9IO/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3 |
| InChIKey | AJQBNKMDLPNOAK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|