C11H9F5O — CID 91656526
1-(2,3-dimethylphenyl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 91656526) has the molecular formula C11H9F5O and a molecular weight of 252.18 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(2,3-dimethylphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 91656526 |
| Molecular Formula | C11H9F5O |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | Cc1cccc(C(=O)C(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C11H9F5O/c1-6-4-3-5-8(7(6)2)9(17)10(12,13)11(14,15)16/h3-5H,1-2H3 |
| InChIKey | UGRTWWCPLHRPFX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|