C13H10F6O3 — CID 146004397
5-(2,3-dimethylphenyl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid (PubChem CID 146004397) has the molecular formula C13H10F6O3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 5-(2,3-dimethylphenyl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid.
| Compound Name | 5-(2,3-dimethylphenyl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146004397 |
| Molecular Formula | C13H10F6O3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 5-(2,3-dimethylphenyl)-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
| SMILES | Cc1cccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O)c1C |
| InChI | InChI=1S/C13H10F6O3/c1-6-4-3-5-8(7(6)2)9(20)11(14,15)13(18,19)12(16,17)10(21)22/h3-5H,1-2H3,(H,21,22) |
| InChIKey | MEFKSCRODNBCPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|