C11H11F3O — CID 62548173
1-(2,3-dimethylphenyl)-3,3,3-trifluoropropan-1-one (PubChem CID 62548173) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-(2,3-dimethylphenyl)-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 62548173 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3,3,3-trifluoropropan-1-one |
| SMILES | Cc1cccc(C(=O)CC(F)(F)F)c1C |
| InChI | InChI=1S/C11H11F3O/c1-7-4-3-5-9(8(7)2)10(15)6-11(12,13)14/h3-5H,6H2,1-2H3 |
| InChIKey | USTGJFPUXXUJHO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |