C16H22O — CID 114970182
3-cyclopentyl-1-(2,3-dimethylphenyl)propan-1-one (PubChem CID 114970182) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-cyclopentyl-1-(2,3-dimethylphenyl)propan-1-one.
| Compound Name | 3-cyclopentyl-1-(2,3-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 114970182 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-cyclopentyl-1-(2,3-dimethylphenyl)propan-1-one |
| SMILES | Cc1cccc(C(=O)CCC2CCCC2)c1C |
| InChI | InChI=1S/C16H22O/c1-12-6-5-9-15(13(12)2)16(17)11-10-14-7-3-4-8-14/h5-6,9,14H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | ICOIXFSWDFWSIX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |