C14H20O2 — CID 103023156
1-(2,3-dimethylphenyl)-3-methoxy-3-methylbutan-1-one (PubChem CID 103023156) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-methoxy-3-methylbutan-1-one.
| Compound Name | 1-(2,3-dimethylphenyl)-3-methoxy-3-methylbutan-1-one |
|---|---|
| PubChem CID | 103023156 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-methoxy-3-methylbutan-1-one |
| SMILES | COC(C)(C)CC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C14H20O2/c1-10-7-6-8-12(11(10)2)13(15)9-14(3,4)16-5/h6-8H,9H2,1-5H3 |
| InChIKey | PDTDYGSRLSRQMN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |