C17H19NO3 — CID 67422539
azane;1-(2,3-dimethylphenyl)-2-(2-hydroxy-3-methylphenyl)ethane-1,2-dione (PubChem CID 67422539) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is azane;1-(2,3-dimethylphenyl)-2-(2-hydroxy-3-methylphenyl)ethane-1,2-dione.
| Compound Name | azane;1-(2,3-dimethylphenyl)-2-(2-hydroxy-3-methylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 67422539 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | azane;1-(2,3-dimethylphenyl)-2-(2-hydroxy-3-methylphenyl)ethane-1,2-dione |
| SMILES | Cc1cccc(C(=O)C(=O)c2cccc(C)c2O)c1C.N |
| InChI | InChI=1S/C17H16O3.H3N/c1-10-6-4-8-13(12(10)3)16(19)17(20)14-9-5-7-11(2)15(14)18;/h4-9,18H,1-3H3;1H3 |
| InChIKey | UDWCQDVWOXPSDW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|