C13H14O2 — CID 91616312
1-cyclopropyl-2-(2,3-dimethylphenyl)ethane-1,2-dione (PubChem CID 91616312) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,3-dimethylphenyl)ethane-1,2-dione.
| Compound Name | 1-cyclopropyl-2-(2,3-dimethylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 91616312 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 1-cyclopropyl-2-(2,3-dimethylphenyl)ethane-1,2-dione |
| SMILES | Cc1cccc(C(=O)C(=O)C2CC2)c1C |
| InChI | InChI=1S/C13H14O2/c1-8-4-3-5-11(9(8)2)13(15)12(14)10-6-7-10/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | XZAZDWBDKCGLQW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|