C18H24O — CID 112743626
2,2-di(cyclobutyl)-1-(2,3-dimethylphenyl)ethanone (PubChem CID 112743626) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 2,2-di(cyclobutyl)-1-(2,3-dimethylphenyl)ethanone.
| Compound Name | 2,2-di(cyclobutyl)-1-(2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 112743626 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2,2-di(cyclobutyl)-1-(2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)C(C2CCC2)C2CCC2)c1C |
| InChI | InChI=1S/C18H24O/c1-12-6-3-11-16(13(12)2)18(19)17(14-7-4-8-14)15-9-5-10-15/h3,6,11,14-15,17H,4-5,7-10H2,1-2H3 |
| InChIKey | VDBXRDAKBGJCBZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |