C15H18O3 — CID 90476274
cis-(1S,2R)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid (PubChem CID 90476274) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is cis-(1S,2R)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 90476274 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | cis-(1S,2R)-2-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid |
| SMILES | Cc1cccc(C(=O)[C@@H]2CCC[C@@H]2C(=O)O)c1C |
| InChI | InChI=1S/C15H18O3/c1-9-5-3-6-11(10(9)2)14(16)12-7-4-8-13(12)15(17)18/h3,5-6,12-13H,4,7-8H2,1-2H3,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | FQEGSIOKFYJWIQ-OLZOCXBDSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |