cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid

C15H18O3 — CID 24722414

IUPACcis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid
SMILESCc1ccccc1C(=O)[C@H]1CCCC[C@H]1C(=O)O
InChIInChI=1S/C15H18O3/c1-10-6-2-3-7-11(10)14(16)12-8-4-5-9-13(12)15(17)18/h2-3,6-7,12-13H,4-5,8-9H2,1H3,(H,17,18)/t12-,13+/m0/s1
InChIKeyFZGOZGATZZWODF-QWHCGFSZSA-N
MW246.31 g/mol
LogP3.07
Rot. Bonds3

About cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid

cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid (PubChem CID 24722414) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid
PubChem CID24722414
Molecular FormulaC15H18O3
Molecular Weight246.31 g/mol
Exact Mass246.13
IUPAC Namecis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid
SMILESCc1ccccc1C(=O)[C@H]1CCCC[C@H]1C(=O)O
InChIInChI=1S/C15H18O3/c1-10-6-2-3-7-11(10)14(16)12-8-4-5-9-13(12)15(17)18/h2-3,6-7,12-13H,4-5,8-9H2,1H3,(H,17,18)/t12-,13+/m0/s1
InChIKeyFZGOZGATZZWODF-QWHCGFSZSA-N
XLogP3.07
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.31
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid (CID 24722414) is cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid is Cc1ccccc1C(=O)[C@H]1CCCC[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid?
The InChIKey is FZGOZGATZZWODF-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H18O3/c1-10-6-2-3-7-11(10)14(16)12-8-4-5-9-13(12)15(17)18/h2-3,6-7,12-13H,4-5,8-9H2,1H3,(H,17,18)/t12-,13+/m0/s1.
What are the key properties of cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid?
cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid has a molecular weight of 246.31 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-(2-methylbenzoyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 24722414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).