C22H22O4 — CID 160819171
anthracene;cyclohexane-1,2-dicarboxylic acid (PubChem CID 160819171) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is anthracene;cyclohexane-1,2-dicarboxylic acid.
| Compound Name | anthracene;cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 160819171 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | anthracene;cyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(=O)O.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C8H12O4/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;9-7(10)5-3-1-2-4-6(5)8(11)12/h1-10H;5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | SFHOXNXZRJKEIA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|