C19H17NO4 — CID 142013394
(2R)-2-[(1,3-dioxobenzo[f]isoindol-2-yl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 142013394) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-2-[(1,3-dioxobenzo[f]isoindol-2-yl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | (2R)-2-[(1,3-dioxobenzo[f]isoindol-2-yl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 142013394 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2R)-2-[(1,3-dioxobenzo[f]isoindol-2-yl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC[C@H]1CN1C(=O)c2cc3ccccc3cc2C1=O |
| InChI | InChI=1S/C19H17NO4/c21-17-15-8-11-4-1-2-5-12(11)9-16(15)18(22)20(17)10-13-6-3-7-14(13)19(23)24/h1-2,4-5,8-9,13-14H,3,6-7,10H2,(H,23,24)/t13-,14?/m0/s1 |
| InChIKey | IHQUSXIZUCGIFY-LSLKUGRBSA-N |
| XLogP | 2.94 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|