C22H28N2O5 — CID 108786803
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 108786803) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108786803 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C22H28N2O5/c1-13(2)11-18(22(28)29)23-19(25)15-8-4-3-7-14(15)12-24-20(26)16-9-5-6-10-17(16)21(24)27/h5-6,9-10,13-15,18H,3-4,7-8,11-12H2,1-2H3,(H,23,25)(H,28,29) |
| InChIKey | QFCJLSBXZGRSNM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|