About 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 108786803) has the molecular formula C22H28N2O5
and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
| PubChem CID | 108786803 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C22H28N2O5/c1-13(2)11-18(22(28)29)23-19(25)15-8-4-3-7-14(15)12-24-20(26)16-9-5-6-10-17(16)21(24)27/h5-6,9-10,13-15,18H,3-4,7-8,11-12H2,1-2H3,(H,23,25)(H,28,29) |
| InChIKey | QFCJLSBXZGRSNM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid?
The IUPAC name of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid (CID 108786803) is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid?
The canonical SMILES for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid is CC(C)CC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O.
What is the InChIKey of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid?
The InChIKey is QFCJLSBXZGRSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O5/c1-13(2)11-18(22(28)29)23-19(25)15-8-4-3-7-14(15)12-24-20(26)16-9-5-6-10-17(16)21(24)27/h5-6,9-10,13-15,18H,3-4,7-8,11-12H2,1-2H3,(H,23,25)(H,28,29).
What are the key properties of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid?
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid has a molecular weight of 400.48 g/mol, XLogP of 2.70, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]-4-methylpentanoic acid is sourced from PubChem (CID 108786803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).