C19H24N2O4 — CID 108786916
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-hydroxypropyl)cyclohexane-1-carboxamide (PubChem CID 108786916) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-hydroxypropyl)cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-hydroxypropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108786916 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-hydroxypropyl)cyclohexane-1-carboxamide |
| SMILES | CC(O)CNC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-12(22)10-20-17(23)14-7-3-2-6-13(14)11-21-18(24)15-8-4-5-9-16(15)19(21)25/h4-5,8-9,12-14,22H,2-3,6-7,10-11H2,1H3,(H,20,23) |
| InChIKey | QVMCTXDELCUUGE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|