About 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid (PubChem CID 108786872) has the molecular formula C21H26N2O5
and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid.
Molecular Properties
| Compound Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid |
| PubChem CID | 108786872 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C21H26N2O5/c1-2-7-17(21(27)28)22-18(24)14-9-4-3-8-13(14)12-23-19(25)15-10-5-6-11-16(15)20(23)26/h5-6,10-11,13-14,17H,2-4,7-9,12H2,1H3,(H,22,24)(H,27,28) |
| InChIKey | WFJLGQHMZWWGRS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid?
The IUPAC name of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid (CID 108786872) is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid.
What is the SMILES notation for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid?
The canonical SMILES for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid is CCCC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O.
What is the InChIKey of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid?
The InChIKey is WFJLGQHMZWWGRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O5/c1-2-7-17(21(27)28)22-18(24)14-9-4-3-8-13(14)12-23-19(25)15-10-5-6-11-16(15)20(23)26/h5-6,10-11,13-14,17H,2-4,7-9,12H2,1H3,(H,22,24)(H,27,28).
What are the key properties of 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid?
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid has a molecular weight of 386.45 g/mol, XLogP of 2.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid is sourced from PubChem (CID 108786872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).