C21H26N2O5 — CID 108786872
2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid (PubChem CID 108786872) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 108786872 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[[2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexanecarbonyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)C1CCCCC1CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C21H26N2O5/c1-2-7-17(21(27)28)22-18(24)14-9-4-3-8-13(14)12-23-19(25)15-10-5-6-11-16(15)20(23)26/h5-6,10-11,13-14,17H,2-4,7-9,12H2,1H3,(H,22,24)(H,27,28) |
| InChIKey | WFJLGQHMZWWGRS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|