C21H24N4O3S — CID 108799856
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 108799856) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108799856 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | CCCc1nnc(NC(=O)C2CCCCC2CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C21H24N4O3S/c1-2-7-17-23-24-21(29-17)22-18(26)14-9-4-3-8-13(14)12-25-19(27)15-10-5-6-11-16(15)20(25)28/h5-6,10-11,13-14H,2-4,7-9,12H2,1H3,(H,22,24,26) |
| InChIKey | HFTAXBKLOKXRHF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|