C24H23N3O4S — CID 108799815
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 108799815) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108799815 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)C3CCCCC3CN3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C24H23N3O4S/c1-31-15-10-11-19-20(12-15)32-24(25-19)26-21(28)16-7-3-2-6-14(16)13-27-22(29)17-8-4-5-9-18(17)23(27)30/h4-5,8-12,14,16H,2-3,6-7,13H2,1H3,(H,25,26,28) |
| InChIKey | ZXEQGKHMUFJZEQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|