C15H18N2O2S — CID 739502
N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexanecarboxamide (PubChem CID 739502) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 739502 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)cyclohexanecarboxamide |
| SMILES | COc1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-19-11-7-8-12-13(9-11)20-15(16-12)17-14(18)10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H,16,17,18) |
| InChIKey | LLYWXSGKKWFVTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |