C21H22N4O3S — CID 17488727
3-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 17488727) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 17488727 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-N-(6-methoxy-1,3-benzothiazol-2-yl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | COc1ccc2nc(NC(=O)C3CCCN(C(=O)Nc4ccccc4)C3)sc2c1 |
| InChI | InChI=1S/C21H22N4O3S/c1-28-16-9-10-17-18(12-16)29-20(23-17)24-19(26)14-6-5-11-25(13-14)21(27)22-15-7-3-2-4-8-15/h2-4,7-10,12,14H,5-6,11,13H2,1H3,(H,22,27)(H,23,24,26) |
| InChIKey | NHPBMQDJOARXEM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |