C23H24N4O3S — CID 55628957
N-(6-acetamido-1,3-benzothiazol-2-yl)-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55628957) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55628957 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)C3CCCN(C(=O)Cc4ccccc4)C3)sc2c1 |
| InChI | InChI=1S/C23H24N4O3S/c1-15(28)24-18-9-10-19-20(13-18)31-23(25-19)26-22(30)17-8-5-11-27(14-17)21(29)12-16-6-3-2-4-7-16/h2-4,6-7,9-10,13,17H,5,8,11-12,14H2,1H3,(H,24,28)(H,25,26,30) |
| InChIKey | JXPQWLRWLIRBIN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |