C22H24N4O3 — CID 108799768
N-(4,6-dimethylpyrimidin-2-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 108799768) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108799768 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)C2CCCCC2CN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C22H24N4O3/c1-13-11-14(2)24-22(23-13)25-19(27)16-8-4-3-7-15(16)12-26-20(28)17-9-5-6-10-18(17)21(26)29/h5-6,9-11,15-16H,3-4,7-8,12H2,1-2H3,(H,23,24,25,27) |
| InChIKey | NQDYBGKFQQMSSM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|