C26H23N5O3S — CID 108727927
2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 108727927) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 108727927 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1nc2scc(-c3ccccc3)n2n1)C1CCCCC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H23N5O3S/c32-22(27-25-28-26-31(29-25)21(15-35-26)16-8-2-1-3-9-16)18-11-5-4-10-17(18)14-30-23(33)19-12-6-7-13-20(19)24(30)34/h1-3,6-9,12-13,15,17-18H,4-5,10-11,14H2,(H,27,29,32) |
| InChIKey | SJZNKKZIDZHBQM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|