C15H15ClN4OS — CID 108751761
3-chloro-2,2-dimethyl-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide (PubChem CID 108751761) has the molecular formula C15H15ClN4OS and a molecular weight of 334.83 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide |
|---|---|
| PubChem CID | 108751761 |
| Molecular Formula | C15H15ClN4OS |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1nc2scc(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C15H15ClN4OS/c1-15(2,9-16)12(21)17-13-18-14-20(19-13)11(8-22-14)10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,17,19,21) |
| InChIKey | OQEPRYGNNMBSBA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|