C13H11ClN4O2S — CID 108729063
2-chloro-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]acetamide (PubChem CID 108729063) has the molecular formula C13H11ClN4O2S and a molecular weight of 322.78 g/mol. Its IUPAC name is 2-chloro-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]acetamide |
|---|---|
| PubChem CID | 108729063 |
| Molecular Formula | C13H11ClN4O2S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-chloro-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2csc3nc(NC(=O)CCl)nn23)cc1 |
| InChI | InChI=1S/C13H11ClN4O2S/c1-20-9-4-2-8(3-5-9)10-7-21-13-16-12(17-18(10)13)15-11(19)6-14/h2-5,7H,6H2,1H3,(H,15,17,19) |
| InChIKey | WNXGIVSQYDUEFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|