C14H15N5OS2 — CID 108780813
1-ethyl-3-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]thiourea (PubChem CID 108780813) has the molecular formula C14H15N5OS2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-ethyl-3-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]thiourea.
| Compound Name | 1-ethyl-3-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]thiourea |
|---|---|
| PubChem CID | 108780813 |
| Molecular Formula | C14H15N5OS2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-ethyl-3-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]thiourea |
| SMILES | CCNC(=S)Nc1nc2scc(-c3ccc(OC)cc3)n2n1 |
| InChI | InChI=1S/C14H15N5OS2/c1-3-15-13(21)16-12-17-14-19(18-12)11(8-22-14)9-4-6-10(20-2)7-5-9/h4-8H,3H2,1-2H3,(H2,15,16,18,21) |
| InChIKey | DADZBZOBWJCLDE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|