C21H19ClN4O3S — CID 108752923
4-(4-chlorophenoxy)-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide (PubChem CID 108752923) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108752923 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[6-(4-methoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]butanamide |
| SMILES | COc1ccc(-c2csc3nc(NC(=O)CCCOc4ccc(Cl)cc4)nn23)cc1 |
| InChI | InChI=1S/C21H19ClN4O3S/c1-28-16-8-4-14(5-9-16)18-13-30-21-24-20(25-26(18)21)23-19(27)3-2-12-29-17-10-6-15(22)7-11-17/h4-11,13H,2-3,12H2,1H3,(H,23,25,27) |
| InChIKey | OUZBRJGMNKWRPK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|