C21H18Cl2N4O3S — CID 108764912
N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 108764912) has the molecular formula C21H18Cl2N4O3S and a molecular weight of 477.37 g/mol. Its IUPAC name is N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 108764912 |
| Molecular Formula | C21H18Cl2N4O3S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N-[6-(2,5-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2nc3scc(-c4cc(Cl)ccc4Cl)n3n2)cc1 |
| InChI | InChI=1S/C21H18Cl2N4O3S/c1-29-14-5-7-15(8-6-14)30-10-2-3-19(28)24-20-25-21-27(26-20)18(12-31-21)16-11-13(22)4-9-17(16)23/h4-9,11-12H,2-3,10H2,1H3,(H,24,26,28) |
| InChIKey | QCNQFISPFHLBIE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|