C24H18Cl2N4O2S — CID 108752526
N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide (PubChem CID 108752526) has the molecular formula C24H18Cl2N4O2S and a molecular weight of 497.41 g/mol. Its IUPAC name is N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide.
| Compound Name | N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 108752526 |
| Molecular Formula | C24H18Cl2N4O2S |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[6-(2,4-dichlorophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-4-naphthalen-2-yloxybutanamide |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)Nc1nc2scc(-c3ccc(Cl)cc3Cl)n2n1 |
| InChI | InChI=1S/C24H18Cl2N4O2S/c25-17-8-10-19(20(26)13-17)21-14-33-24-28-23(29-30(21)24)27-22(31)6-3-11-32-18-9-7-15-4-1-2-5-16(15)12-18/h1-2,4-5,7-10,12-14H,3,6,11H2,(H,27,29,31) |
| InChIKey | MBZKXANJVXDXAY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|